Benzoic acid, 3-(acetylamino)-5-borono-

Benzoic acid, 3-(acetylamino)-5-borono- - Names and Identifiers

Name	3-ACETAMIDO-5-CARBOXYBENZENEBORONIC ACID 98
Synonyms	3-acetamido-5-borono-benzoic acid Benzoic acid, 3-(acetylamino)-5-borono- 3-Acetamido-5-Carboxybenzeneboronic Acid (3-Acetamido-5-carboxy)phenylboronic acid 3-(dihydroxyboryl)-5-acetamidobenzoic acid 3-ACETAMIDO-5-CARBOXYBENZENEBORONIC ACID 98
CAS	108749-15-1
InChI	InChI=1/C9H10BNO5/c1-5(12)11-8-3-6(9(13)14)2-7(4-8)10(15)16/h2-4,15-16H,1H3,(H,11,12)(H,13,14)

Benzoic acid, 3-(acetylamino)-5-borono- - Physico-chemical Properties

Molecular Formula	C9H10BNO5
Molar Mass	222.99
Density	1.43g/cm³
Melting Point	240-243℃
Storage Condition	2-8°C
Refractive Index	1.593

Benzoic acid, 3-(acetylamino)-5-borono- - Risk and Safety

Hazard Symbols	Xi - Irritant
Hazard Note	Irritant

Benzoic acid, 3-(acetylamino)-5-borono- - Introduction

3-Acetamido-5-borobenzoic acid is an organic compound with the chemical formula C10H10BNO4. Its nature is as follows:

1. appearance: 3-acetyl amino -5-boron benzoic acid is colorless or slightly yellow crystal powder.
2. melting point: about 220 ℃.
3. Solubility: Soluble in polar organic solvents, such as alcohols and ketones, slightly soluble in non-polar solvents.
4. Stability: 3-acetylamino-5-borobenzoic acid is stable at room temperature, but will decompose at high temperature.

The main uses of 3-acetamido-5-borobenzoic acid include the following:

1. Catalyst: Because it contains boron atoms, it is often used as a precursor of platinum catalysts and can be used for hydrogenation and oxidation reactions.
2. Fluorescent probe: It can be used as a fluorescent marker for biological molecules and is used as a fluorescent probe in biological and pharmaceutical research.
3. Antibacterial agents: Some studies have shown that 3-acetylamino-5-borobenzoic acid has certain antibacterial activity and is used to inhibit the growth of bacteria.

The preparation method and safety information of 3-acetamido-5-borobenzoic acid are as follows:

preparation method: 3-acetylamino-5-borobenzoic acid can be obtained by reacting benzoyl chloride with 3-ethanolamine.

Safety Information: 3-Acetamido-5-borobenzoic acid does not pose a significant hazard under normal operating conditions. However, the following matters still need to be paid attention to during use:
1. avoid contact with skin and eyes, such as contact with the application of plenty of water rinse.
2. Wear appropriate protective gloves and glasses during operation.
3. avoid inhalation of its dust or vapor, should be in a well ventilated area for operation.
4. storage should be kept in a cool, dry, ventilated place, away from fire and combustibles.

Last Update：2024-04-10 22:41:03